C35H39N5O2 — CID 89377046
2-[3-[(2S,5R)-5-benzyl-1-(3-methylbenzoyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine (PubChem CID 89377046) has the molecular formula C35H39N5O2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-5-benzyl-1-(3-methylbenzoyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-5-benzyl-1-(3-methylbenzoyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 89377046 |
| Molecular Formula | C35H39N5O2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 2-[3-[(2S,5R)-5-benzyl-1-(3-methylbenzoyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
| SMILES | Cc1cccc(C(=O)N2C[C@@H](Cc3ccccc3)N(C(=O)Cc3ccc4ccccc4c3)C[C@@H]2CCCN=C(N)N)c1 |
| InChI | InChI=1S/C35H39N5O2/c1-25-9-7-14-30(19-25)34(42)40-24-32(21-26-10-3-2-4-11-26)39(23-31(40)15-8-18-38-35(36)37)33(41)22-27-16-17-28-12-5-6-13-29(28)20-27/h2-7,9-14,16-17,19-20,31-32H,8,15,18,21-24H2,1H3,(H4,36,37,38)/t31-,32+/m0/s1 |
| InChIKey | RKFCCFCMNVASNZ-AJQTZOPKSA-N |
| XLogP | 4.71 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|