C41H40Cl2N4O2 — CID 89376985
1-[(2R,5S)-5-[3-(1-aminoethenylamino)propyl]-2-benzyl-4-[3-(3,4-dichlorophenyl)benzoyl]piperazin-1-yl]-2-naphthalen-2-ylethanone (PubChem CID 89376985) has the molecular formula C41H40Cl2N4O2 and a molecular weight of 691.70 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[3-(1-aminoethenylamino)propyl]-2-benzyl-4-[3-(3,4-dichlorophenyl)benzoyl]piperazin-1-yl]-2-naphthalen-2-ylethanone.
| Compound Name | 1-[(2R,5S)-5-[3-(1-aminoethenylamino)propyl]-2-benzyl-4-[3-(3,4-dichlorophenyl)benzoyl]piperazin-1-yl]-2-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 89376985 |
| Molecular Formula | C41H40Cl2N4O2 |
| Molecular Weight | 691.70 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 1-[(2R,5S)-5-[3-(1-aminoethenylamino)propyl]-2-benzyl-4-[3-(3,4-dichlorophenyl)benzoyl]piperazin-1-yl]-2-naphthalen-2-ylethanone |
| SMILES | C=C(N)NCCC[C@H]1CN(C(=O)Cc2ccc3ccccc3c2)[C@H](Cc2ccccc2)CN1C(=O)c1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C41H40Cl2N4O2/c1-28(44)45-20-8-15-36-26-46(40(48)23-30-16-17-31-11-5-6-12-32(31)21-30)37(22-29-9-3-2-4-10-29)27-47(36)41(49)35-14-7-13-33(24-35)34-18-19-38(42)39(43)25-34/h2-7,9-14,16-19,21,24-25,36-37,45H,1,8,15,20,22-23,26-27,44H2/t36-,37+/m0/s1 |
| InChIKey | AJAYPEIGROAHLX-PQQNNWGCSA-N |
| XLogP | 8.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.70 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|