C40H39Cl2N5O2 — CID 12000824
2-[3-[(2S,5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine (PubChem CID 12000824) has the molecular formula C40H39Cl2N5O2 and a molecular weight of 692.69 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 12000824 |
| Molecular Formula | C40H39Cl2N5O2 |
| Molecular Weight | 692.69 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | 2-[3-[(2S,5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@H]1CN(C(=O)Cc2ccc3ccccc3c2)[C@H](Cc2ccccc2)CN1C(=O)c1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C40H39Cl2N5O2/c41-36-18-17-32(24-37(36)42)31-12-6-13-33(23-31)39(49)47-26-35(21-27-8-2-1-3-9-27)46(25-34(47)14-7-19-45-40(43)44)38(48)22-28-15-16-29-10-4-5-11-30(29)20-28/h1-6,8-13,15-18,20,23-24,34-35H,7,14,19,21-22,25-26H2,(H4,43,44,45)/t34-,35+/m0/s1 |
| InChIKey | PWFRJXZJOKGJJF-OIDHKYIRSA-N |
| XLogP | 7.37 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.69 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|