C35H42ClN5O3 — CID 69169851
2-[3-[(2S,5R)-1-[(1S,2R)-2-(4-chlorobenzoyl)cyclohexanecarbonyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine (PubChem CID 69169851) has the molecular formula C35H42ClN5O3 and a molecular weight of 616.21 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-1-[(1S,2R)-2-(4-chlorobenzoyl)cyclohexanecarbonyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-1-[(1S,2R)-2-(4-chlorobenzoyl)cyclohexanecarbonyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 69169851 |
| Molecular Formula | C35H42ClN5O3 |
| Molecular Weight | 616.21 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 2-[3-[(2S,5R)-1-[(1S,2R)-2-(4-chlorobenzoyl)cyclohexanecarbonyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
| SMILES | C[C@@H]1CN(C(=O)[C@H]2CCCC[C@H]2C(=O)c2ccc(Cl)cc2)[C@@H](CCCN=C(N)N)CN1C(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H42ClN5O3/c1-23-21-41(34(44)31-11-5-4-10-30(31)33(43)26-14-16-28(36)17-15-26)29(9-6-18-39-35(37)38)22-40(23)32(42)20-24-12-13-25-7-2-3-8-27(25)19-24/h2-3,7-8,12-17,19,23,29-31H,4-6,9-11,18,20-22H2,1H3,(H4,37,38,39)/t23-,29+,30-,31+/m1/s1 |
| InChIKey | XHGRTTBIYOANKX-XEYRIRSISA-N |
| XLogP | 5.21 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.21 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|