C40H43N5O — CID 12000914
2-[3-[(2S,5R)-5-benzyl-4-(2-naphthalen-2-ylacetyl)-1-[(2-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine (PubChem CID 12000914) has the molecular formula C40H43N5O and a molecular weight of 609.82 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-5-benzyl-4-(2-naphthalen-2-ylacetyl)-1-[(2-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-5-benzyl-4-(2-naphthalen-2-ylacetyl)-1-[(2-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 12000914 |
| Molecular Formula | C40H43N5O |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | 2-[3-[(2S,5R)-5-benzyl-4-(2-naphthalen-2-ylacetyl)-1-[(2-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@H]1CN(C(=O)Cc2ccc3ccccc3c2)[C@H](Cc2ccccc2)CN1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C40H43N5O/c41-40(42)43-23-11-19-36-29-45(39(46)26-31-21-22-32-14-7-8-17-34(32)24-31)37(25-30-12-3-1-4-13-30)28-44(36)27-35-18-9-10-20-38(35)33-15-5-2-6-16-33/h1-10,12-18,20-22,24,36-37H,11,19,23,25-29H2,(H4,41,42,43)/t36-,37+/m0/s1 |
| InChIKey | YNDGLDISZHYWJT-PQQNNWGCSA-N |
| XLogP | 6.43 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|