C25H28N2O — CID 143412464
1-[(5S)-2-benzyl-4,5-dimethylpiperazin-1-yl]-2-naphthalen-2-ylethanone (PubChem CID 143412464) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[(5S)-2-benzyl-4,5-dimethylpiperazin-1-yl]-2-naphthalen-2-ylethanone.
| Compound Name | 1-[(5S)-2-benzyl-4,5-dimethylpiperazin-1-yl]-2-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 143412464 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[(5S)-2-benzyl-4,5-dimethylpiperazin-1-yl]-2-naphthalen-2-ylethanone |
| SMILES | C[C@H]1CN(C(=O)Cc2ccc3ccccc3c2)C(Cc2ccccc2)CN1C |
| InChI | InChI=1S/C25H28N2O/c1-19-17-27(24(18-26(19)2)15-20-8-4-3-5-9-20)25(28)16-21-12-13-22-10-6-7-11-23(22)14-21/h3-14,19,24H,15-18H2,1-2H3/t19-,24?/m0/s1 |
| InChIKey | ULFYHKMMQHJBSM-XGLRFROISA-N |
| XLogP | 4.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |