C40H42ClN5O — CID 12000913
2-[3-[(2S,5R)-5-benzyl-1-[[3-(4-chlorophenyl)phenyl]methyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine (PubChem CID 12000913) has the molecular formula C40H42ClN5O and a molecular weight of 644.26 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-5-benzyl-1-[[3-(4-chlorophenyl)phenyl]methyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-5-benzyl-1-[[3-(4-chlorophenyl)phenyl]methyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 12000913 |
| Molecular Formula | C40H42ClN5O |
| Molecular Weight | 644.26 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | 2-[3-[(2S,5R)-5-benzyl-1-[[3-(4-chlorophenyl)phenyl]methyl]-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@H]1CN(C(=O)Cc2ccc3ccccc3c2)[C@H](Cc2ccccc2)CN1Cc1cccc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C40H42ClN5O/c41-36-19-17-33(18-20-36)35-13-6-10-31(23-35)26-45-27-38(24-29-8-2-1-3-9-29)46(28-37(45)14-7-21-44-40(42)43)39(47)25-30-15-16-32-11-4-5-12-34(32)22-30/h1-6,8-13,15-20,22-23,37-38H,7,14,21,24-28H2,(H4,42,43,44)/t37-,38+/m0/s1 |
| InChIKey | SDDYMZXDSUBLNT-QPPIDDCLSA-N |
| XLogP | 7.08 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|