C27H23NO3 — CID 91241436
2-[3-[4-[1-(naphthalen-2-ylmethoxyamino)ethenyl]phenyl]phenyl]acetic acid (PubChem CID 91241436) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[3-[4-[1-(naphthalen-2-ylmethoxyamino)ethenyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[1-(naphthalen-2-ylmethoxyamino)ethenyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 91241436 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-[3-[4-[1-(naphthalen-2-ylmethoxyamino)ethenyl]phenyl]phenyl]acetic acid |
| SMILES | C=C(NOCc1ccc2ccccc2c1)c1ccc(-c2cccc(CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H23NO3/c1-19(28-31-18-21-9-10-23-6-2-3-7-25(23)16-21)22-11-13-24(14-12-22)26-8-4-5-20(15-26)17-27(29)30/h2-16,28H,1,17-18H2,(H,29,30) |
| InChIKey | XCNDEZUGBHYPKP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|