C26H28N2O3 — CID 91232093
4-[[4-[1-[(4-phenylphenyl)methoxyamino]ethenyl]phenyl]methylamino]butanoic acid (PubChem CID 91232093) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[[4-[1-[(4-phenylphenyl)methoxyamino]ethenyl]phenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-[1-[(4-phenylphenyl)methoxyamino]ethenyl]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 91232093 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[[4-[1-[(4-phenylphenyl)methoxyamino]ethenyl]phenyl]methylamino]butanoic acid |
| SMILES | C=C(NOCc1ccc(-c2ccccc2)cc1)c1ccc(CNCCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-20(23-13-9-21(10-14-23)18-27-17-5-8-26(29)30)28-31-19-22-11-15-25(16-12-22)24-6-3-2-4-7-24/h2-4,6-7,9-16,27-28H,1,5,8,17-19H2,(H,29,30) |
| InChIKey | JYDGKEAWKJPUES-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|