C26H28N2O4 — CID 91349332
3-[[4-[1-[[4-(3-methoxyphenyl)phenyl]methoxyamino]ethenyl]phenyl]methylamino]propanoic acid (PubChem CID 91349332) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-[[4-[1-[[4-(3-methoxyphenyl)phenyl]methoxyamino]ethenyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[1-[[4-(3-methoxyphenyl)phenyl]methoxyamino]ethenyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 91349332 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-[[4-[1-[[4-(3-methoxyphenyl)phenyl]methoxyamino]ethenyl]phenyl]methylamino]propanoic acid |
| SMILES | C=C(NOCc1ccc(-c2cccc(OC)c2)cc1)c1ccc(CNCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-19(22-10-6-20(7-11-22)17-27-15-14-26(29)30)28-32-18-21-8-12-23(13-9-21)24-4-3-5-25(16-24)31-2/h3-13,16,27-28H,1,14-15,17-18H2,2H3,(H,29,30) |
| InChIKey | NACOWWNBLIIRJU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|