C30H27NO5 — CID 59218875
2-[3-[4-methoxy-3-[[(4-phenylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid (PubChem CID 59218875) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[3-[4-methoxy-3-[[(4-phenylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-methoxy-3-[[(4-phenylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59218875 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2-[3-[4-methoxy-3-[[(4-phenylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid |
| SMILES | COc1ccc(-c2cccc(CC(=O)O)c2)cc1CNC(=O)OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27NO5/c1-35-28-15-14-26(25-9-5-6-22(16-25)17-29(32)33)18-27(28)19-31-30(34)36-20-21-10-12-24(13-11-21)23-7-3-2-4-8-23/h2-16,18H,17,19-20H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | SSNWCAAPGSZSHR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |