C27H29NO5 — CID 59219150
2-[3-[4-ethoxy-3-[[(4-ethylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid (PubChem CID 59219150) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[3-[4-ethoxy-3-[[(4-ethylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-ethoxy-3-[[(4-ethylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59219150 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[3-[4-ethoxy-3-[[(4-ethylphenyl)methoxycarbonylamino]methyl]phenyl]phenyl]acetic acid |
| SMILES | CCOc1ccc(-c2cccc(CC(=O)O)c2)cc1CNC(=O)OCc1ccc(CC)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-3-19-8-10-20(11-9-19)18-33-27(31)28-17-24-16-23(12-13-25(24)32-4-2)22-7-5-6-21(14-22)15-26(29)30/h5-14,16H,3-4,15,17-18H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | IXGOIGMOPWLPQU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |