C29H25NO3 — CID 59219180
2-[3-[4-[(E)-C-methyl-N-[(4-phenylphenyl)methoxy]carbonimidoyl]phenyl]phenyl]acetic acid (PubChem CID 59219180) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[3-[4-[(E)-C-methyl-N-[(4-phenylphenyl)methoxy]carbonimidoyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[(E)-C-methyl-N-[(4-phenylphenyl)methoxy]carbonimidoyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59219180 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[3-[4-[(E)-C-methyl-N-[(4-phenylphenyl)methoxy]carbonimidoyl]phenyl]phenyl]acetic acid |
| SMILES | C/C(=N\OCc1ccc(-c2ccccc2)cc1)c1ccc(-c2cccc(CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H25NO3/c1-21(30-33-20-22-10-12-26(13-11-22)25-7-3-2-4-8-25)24-14-16-27(17-15-24)28-9-5-6-23(18-28)19-29(31)32/h2-18H,19-20H2,1H3,(H,31,32)/b30-21+ |
| InChIKey | VAMYUCHMWBKEJS-MWAVMZGNSA-N |
| XLogP | 6.59 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|