C31H34Cl2N6O2 — CID 69169840
2-amino-3-(2,4-dichlorophenyl)-1-[(2S,5R)-5-methyl-4-(2-naphthalen-2-ylacetyl)-2-[3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propan-1-one (PubChem CID 69169840) has the molecular formula C31H34Cl2N6O2 and a molecular weight of 593.56 g/mol. Its IUPAC name is 2-amino-3-(2,4-dichlorophenyl)-1-[(2S,5R)-5-methyl-4-(2-naphthalen-2-ylacetyl)-2-[3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-amino-3-(2,4-dichlorophenyl)-1-[(2S,5R)-5-methyl-4-(2-naphthalen-2-ylacetyl)-2-[3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 69169840 |
| Molecular Formula | C31H34Cl2N6O2 |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 2-amino-3-(2,4-dichlorophenyl)-1-[(2S,5R)-5-methyl-4-(2-naphthalen-2-ylacetyl)-2-[3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propan-1-one |
| SMILES | C[C@@H]1CN(C(=O)C(N)Cc2ccc(Cl)cc2Cl)[C@@H](CCCn2cncn2)CN1C(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H34Cl2N6O2/c1-21-17-39(31(41)29(34)15-25-10-11-26(32)16-28(25)33)27(7-4-12-37-20-35-19-36-37)18-38(21)30(40)14-22-8-9-23-5-2-3-6-24(23)13-22/h2-3,5-6,8-11,13,16,19-21,27,29H,4,7,12,14-15,17-18,34H2,1H3/t21-,27+,29?/m1/s1 |
| InChIKey | SVMPJZUEEQLVKA-NCRCTHSQSA-N |
| XLogP | 4.76 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |