C31H42N6O2 — CID 11455369
2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(4-methoxyphenyl)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine (PubChem CID 11455369) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(4-methoxyphenyl)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(4-methoxyphenyl)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 11455369 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(4-methoxyphenyl)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine |
| SMILES | COc1ccc(C[C@@H](N)C(=O)N2C[C@@H](C)N(CCc3ccc4ccccc4c3)C[C@@H]2CCCN=C(N)N)cc1 |
| InChI | InChI=1S/C31H42N6O2/c1-22-20-37(30(38)29(32)19-23-10-13-28(39-2)14-11-23)27(8-5-16-35-31(33)34)21-36(22)17-15-24-9-12-25-6-3-4-7-26(25)18-24/h3-4,6-7,9-14,18,22,27,29H,5,8,15-17,19-21,32H2,1-2H3,(H4,33,34,35)/t22-,27+,29-/m1/s1 |
| InChIKey | NZMNIZBJTDETIU-KBKXWFDOSA-N |
| XLogP | 2.92 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|