C25H35ClN6O — CID 11271371
2-[3-[(2S)-4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]-1-(2-phenylethyl)piperazin-2-yl]propyl]guanidine (PubChem CID 11271371) has the molecular formula C25H35ClN6O and a molecular weight of 471.05 g/mol. Its IUPAC name is 2-[3-[(2S)-4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]-1-(2-phenylethyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S)-4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]-1-(2-phenylethyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 11271371 |
| Molecular Formula | C25H35ClN6O |
| Molecular Weight | 471.05 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-[3-[(2S)-4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]-1-(2-phenylethyl)piperazin-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@H]1CN(C(=O)[C@H](N)Cc2ccc(Cl)cc2)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C25H35ClN6O/c26-21-10-8-20(9-11-21)17-23(27)24(33)32-16-15-31(14-12-19-5-2-1-3-6-19)22(18-32)7-4-13-30-25(28)29/h1-3,5-6,8-11,22-23H,4,7,12-18,27H2,(H4,28,29,30)/t22-,23+/m0/s1 |
| InChIKey | DVGNOCVIGJEVKL-XZOQPEGZSA-N |
| XLogP | 2.02 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|