C21H24ClN3O2 — CID 119287937
(2S)-2-amino-1-[4-[2-(4-chlorophenyl)acetyl]piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 119287937) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[2-(4-chlorophenyl)acetyl]piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | (2S)-2-amino-1-[4-[2-(4-chlorophenyl)acetyl]piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 119287937 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2S)-2-amino-1-[4-[2-(4-chlorophenyl)acetyl]piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N1CCN(C(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-18-8-6-17(7-9-18)15-20(26)24-10-12-25(13-11-24)21(27)19(23)14-16-4-2-1-3-5-16/h1-9,19H,10-15,23H2/t19-/m0/s1 |
| InChIKey | VTZADJQNCVGCTF-IBGZPJMESA-N |
| XLogP | 2.12 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |