C13H17ClIN3O — CID 143338881
2-amino-3-(4-chlorophenyl)-1-(4-iodopiperazin-1-yl)propan-1-one (PubChem CID 143338881) has the molecular formula C13H17ClIN3O and a molecular weight of 393.66 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)-1-(4-iodopiperazin-1-yl)propan-1-one.
| Compound Name | 2-amino-3-(4-chlorophenyl)-1-(4-iodopiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 143338881 |
| Molecular Formula | C13H17ClIN3O |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-amino-3-(4-chlorophenyl)-1-(4-iodopiperazin-1-yl)propan-1-one |
| SMILES | NC(Cc1ccc(Cl)cc1)C(=O)N1CCN(I)CC1 |
| InChI | InChI=1S/C13H17ClIN3O/c14-11-3-1-10(2-4-11)9-12(16)13(19)17-5-7-18(15)8-6-17/h1-4,12H,5-9,16H2 |
| InChIKey | WOOASQHYGVBRPG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|