C19H31N5OS — CID 57144466
2-[4-[[(2R)-1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylsulfanyl]butyl]guanidine (PubChem CID 57144466) has the molecular formula C19H31N5OS and a molecular weight of 377.56 g/mol. Its IUPAC name is 2-[4-[[(2R)-1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylsulfanyl]butyl]guanidine.
| Compound Name | 2-[4-[[(2R)-1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylsulfanyl]butyl]guanidine |
|---|---|
| PubChem CID | 57144466 |
| Molecular Formula | C19H31N5OS |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[4-[[(2R)-1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylsulfanyl]butyl]guanidine |
| SMILES | NC(N)=NCCCCSC[C@H]1CCCN1C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C19H31N5OS/c20-17(13-15-7-2-1-3-8-15)18(25)24-11-6-9-16(24)14-26-12-5-4-10-23-19(21)22/h1-3,7-8,16-17H,4-6,9-14,20H2,(H4,21,22,23)/t16-,17+/m1/s1 |
| InChIKey | HILGIDZARHPQRF-SJORKVTESA-N |
| XLogP | 1.33 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|