C21H32N6O3 — CID 54465286
(2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 54465286) has the molecular formula C21H32N6O3 and a molecular weight of 416.53 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54465286 |
| Molecular Formula | C21H32N6O3 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccccc1)[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C21H32N6O3/c1-26(16(14-28)9-5-11-25-21(23)24)20(30)18-10-6-12-27(18)19(29)17(22)13-15-7-3-2-4-8-15/h2-4,7-8,14,16-18H,5-6,9-13,22H2,1H3,(H4,23,24,25)/t16-,17-,18-/m0/s1 |
| InChIKey | XEKFDYQEFVMVJG-BZSNNMDCSA-N |
| XLogP | -0.37 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|