C19H32N6O — CID 67846371
2-[4-[[1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylamino]butyl]guanidine (PubChem CID 67846371) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is 2-[4-[[1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylamino]butyl]guanidine.
| Compound Name | 2-[4-[[1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylamino]butyl]guanidine |
|---|---|
| PubChem CID | 67846371 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[4-[[1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidin-2-yl]methylamino]butyl]guanidine |
| SMILES | NC(N)=NCCCCNCC1CCCN1C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C19H32N6O/c20-17(13-15-7-2-1-3-8-15)18(26)25-12-6-9-16(25)14-23-10-4-5-11-24-19(21)22/h1-3,7-8,16-17,23H,4-6,9-14,20H2,(H4,21,22,24)/t16?,17-/m0/s1 |
| InChIKey | KOZIWBAGKSNZHR-DJNXLDHESA-N |
| XLogP | 0.19 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|