C26H36N6O2 — CID 59837876
2-[3-[(2S,5R)-1-[(2R)-2-amino-2-phenylacetyl]-5-methyl-4-(3-phenylpropanoyl)piperazin-2-yl]propyl]guanidine (PubChem CID 59837876) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-1-[(2R)-2-amino-2-phenylacetyl]-5-methyl-4-(3-phenylpropanoyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-1-[(2R)-2-amino-2-phenylacetyl]-5-methyl-4-(3-phenylpropanoyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 59837876 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 2-[3-[(2S,5R)-1-[(2R)-2-amino-2-phenylacetyl]-5-methyl-4-(3-phenylpropanoyl)piperazin-2-yl]propyl]guanidine |
| SMILES | C[C@@H]1CN(C(=O)[C@H](N)c2ccccc2)[C@@H](CCCN=C(N)N)CN1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H36N6O2/c1-19-17-32(25(34)24(27)21-11-6-3-7-12-21)22(13-8-16-30-26(28)29)18-31(19)23(33)15-14-20-9-4-2-5-10-20/h2-7,9-12,19,22,24H,8,13-18,27H2,1H3,(H4,28,29,30)/t19-,22+,24-/m1/s1 |
| InChIKey | YALJUWKHISINOE-WNOPAQSVSA-N |
| XLogP | 1.80 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|