C16H27N5O4 — CID 138596629
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-4-phenylbutanoic acid (PubChem CID 138596629) has the molecular formula C16H27N5O4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-4-phenylbutanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 138596629 |
| Molecular Formula | C16H27N5O4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-4-phenylbutanoic acid |
| SMILES | NC(CCc1ccccc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C10H13NO2.C6H14N4O2/c11-9(10(12)13)7-6-8-4-2-1-3-5-8;7-4(5(11)12)2-1-3-10-6(8)9/h1-5,9H,6-7,11H2,(H,12,13);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | VHXYHLKZTAZYEG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|