C17H30N6O6 — CID 20639043
2-aminoacetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-amino-3-phenylpropanoic acid (PubChem CID 20639043) has the molecular formula C17H30N6O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-aminoacetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-amino-3-phenylpropanoic acid.
| Compound Name | 2-aminoacetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-amino-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 20639043 |
| Molecular Formula | C17H30N6O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-aminoacetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-amino-3-phenylpropanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.NCC(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H14N4O2.C2H5NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-4(5(11)12)2-1-3-10-6(8)9;3-1-2(4)5/h1-5,8H,6,10H2,(H,11,12);4H,1-3,7H2,(H,11,12)(H4,8,9,10);1,3H2,(H,4,5)/t8-;4-;/m00./s1 |
| InChIKey | XXKYZSOMMHOFFI-OMSMUOAWSA-N |
| XLogP | -1.88 |
| TPSA | 254.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|