C16H26N4O4 — CID 11371163
2-amino-5-(diaminomethylideneamino)pentanoic acid;4-phenylbutanoic acid (PubChem CID 11371163) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;4-phenylbutanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;4-phenylbutanoic acid |
|---|---|
| PubChem CID | 11371163 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;4-phenylbutanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)CCCc1ccccc1 |
| InChI | InChI=1S/C10H12O2.C6H14N4O2/c11-10(12)8-4-7-9-5-2-1-3-6-9;7-4(5(11)12)2-1-3-10-6(8)9/h1-3,5-6H,4,7-8H2,(H,11,12);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | MFKPNMWAAYCYDV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|