C27H40N6O8 — CID 89106857
(4S)-4-amino-5-[4-(carboxymethyl)phenoxy]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phenylethanamine (PubChem CID 89106857) has the molecular formula C27H40N6O8 and a molecular weight of 576.65 g/mol. Its IUPAC name is (4S)-4-amino-5-[4-(carboxymethyl)phenoxy]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phenylethanamine.
| Compound Name | (4S)-4-amino-5-[4-(carboxymethyl)phenoxy]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phenylethanamine |
|---|---|
| PubChem CID | 89106857 |
| Molecular Formula | C27H40N6O8 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (4S)-4-amino-5-[4-(carboxymethyl)phenoxy]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phenylethanamine |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.NCCc1ccccc1.N[C@@H](CCC(=O)O)C(=O)Oc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO6.C8H11N.C6H14N4O2/c14-10(5-6-11(15)16)13(19)20-9-3-1-8(2-4-9)7-12(17)18;9-7-6-8-4-2-1-3-5-8;7-4(5(11)12)2-1-3-10-6(8)9/h1-4,10H,5-7,14H2,(H,15,16)(H,17,18);1-5H,6-7,9H2;4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t10-;;4-/m0.0/s1 |
| InChIKey | NHNMVAAGGHBKSZ-LZQRVENASA-N |
| XLogP | 0.05 |
| TPSA | 280.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|