C22H31N5O4 — CID 89106746
2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]acetic acid;2-phenylethanamine (PubChem CID 89106746) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]acetic acid;2-phenylethanamine.
| Compound Name | 2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]acetic acid;2-phenylethanamine |
|---|---|
| PubChem CID | 89106746 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]acetic acid;2-phenylethanamine |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Oc1ccc(CC(=O)O)cc1.NCCc1ccccc1 |
| InChI | InChI=1S/C14H20N4O4.C8H11N/c15-11(2-1-7-18-14(16)17)13(21)22-10-5-3-9(4-6-10)8-12(19)20;9-7-6-8-4-2-1-3-5-8/h3-6,11H,1-2,7-8,15H2,(H,19,20)(H4,16,17,18);1-5H,6-7,9H2/t11-;/m0./s1 |
| InChIKey | BHYQAHOIZOWXCG-MERQFXBCSA-N |
| XLogP | 0.79 |
| TPSA | 180.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|