C19H30N6O6 — CID 57132538
(2S,3R)-2-amino-3-[(2S)-2-amino-3-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]propanoyl]oxybutanoic acid (PubChem CID 57132538) has the molecular formula C19H30N6O6 and a molecular weight of 438.49 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-[(2S)-2-amino-3-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]propanoyl]oxybutanoic acid.
| Compound Name | (2S,3R)-2-amino-3-[(2S)-2-amino-3-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]propanoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 57132538 |
| Molecular Formula | C19H30N6O6 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (2S,3R)-2-amino-3-[(2S)-2-amino-3-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyphenyl]propanoyl]oxybutanoic acid |
| SMILES | C[C@@H](OC(=O)[C@@H](N)Cc1ccc(OC(=O)[C@@H](N)CCCN=C(N)N)cc1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C19H30N6O6/c1-10(15(22)16(26)27)30-18(29)14(21)9-11-4-6-12(7-5-11)31-17(28)13(20)3-2-8-25-19(23)24/h4-7,10,13-15H,2-3,8-9,20-22H2,1H3,(H,26,27)(H4,23,24,25)/t10-,13+,14+,15+/m1/s1 |
| InChIKey | MGDFKNWBNYJELG-KJEVXHAQSA-N |
| XLogP | -1.81 |
| TPSA | 232.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|