C15H22N4O5 — CID 173499927
(2S)-2-amino-3-[4-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxyphenyl]propanoic acid (PubChem CID 173499927) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 173499927 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2S)-2-amino-3-[4-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxyphenyl]propanoic acid |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)Oc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C15H22N4O5/c16-11(2-1-7-19-15(18)23)14(22)24-10-5-3-9(4-6-10)8-12(17)13(20)21/h3-6,11-12H,1-2,7-8,16-17H2,(H,20,21)(H3,18,19,23)/t11-,12-/m0/s1 |
| InChIKey | CACZRUPXSHWCJE-RYUDHWBXSA-N |
| XLogP | -0.68 |
| TPSA | 170.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|