C15H23N3O4 — CID 91045308
(2R)-2-amino-3-[4-[(2S)-2,6-diaminohexanoyl]oxyphenyl]propanoic acid (PubChem CID 91045308) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-[(2S)-2,6-diaminohexanoyl]oxyphenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[4-[(2S)-2,6-diaminohexanoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 91045308 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2R)-2-amino-3-[4-[(2S)-2,6-diaminohexanoyl]oxyphenyl]propanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)Oc1ccc(C[C@@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23N3O4/c16-8-2-1-3-12(17)15(21)22-11-6-4-10(5-7-11)9-13(18)14(19)20/h4-7,12-13H,1-3,8-9,16-18H2,(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | BBIOWUCZVKWIHM-QWHCGFSZSA-N |
| XLogP | 0.00 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|