C14H23N3O5 — CID 89081169
[4-[2-(dihydroxyamino)oxyethyl]phenyl] 2,6-diaminohexanoate (PubChem CID 89081169) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is [4-[2-(dihydroxyamino)oxyethyl]phenyl] 2,6-diaminohexanoate.
| Compound Name | [4-[2-(dihydroxyamino)oxyethyl]phenyl] 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 89081169 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [4-[2-(dihydroxyamino)oxyethyl]phenyl] 2,6-diaminohexanoate |
| SMILES | NCCCCC(N)C(=O)Oc1ccc(CCON(O)O)cc1 |
| InChI | InChI=1S/C14H23N3O5/c15-9-2-1-3-13(16)14(18)22-12-6-4-11(5-7-12)8-10-21-17(19)20/h4-7,13,19-20H,1-3,8-10,15-16H2 |
| InChIKey | CWNQXWWIGUGGMG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|