C15H25N3O2S — CID 122440664
2,6-diamino-N-[2-[4-(sulfanylmethyl)phenoxy]ethyl]hexanamide (PubChem CID 122440664) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2,6-diamino-N-[2-[4-(sulfanylmethyl)phenoxy]ethyl]hexanamide.
| Compound Name | 2,6-diamino-N-[2-[4-(sulfanylmethyl)phenoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 122440664 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2,6-diamino-N-[2-[4-(sulfanylmethyl)phenoxy]ethyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)NCCOc1ccc(CS)cc1 |
| InChI | InChI=1S/C15H25N3O2S/c16-8-2-1-3-14(17)15(19)18-9-10-20-13-6-4-12(11-21)5-7-13/h4-7,14,21H,1-3,8-11,16-17H2,(H,18,19) |
| InChIKey | KRZGOJAGTNXLBL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|