C38H70N8O6S2 — CID 158439544
(2S,9S)-2,9,13-triamino-N-[2-[4,5-bis(sulfanylmethyl)-2-[2-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]ethoxy]phenoxy]ethyl]-8-oxotridecanamide (PubChem CID 158439544) has the molecular formula C38H70N8O6S2 and a molecular weight of 799.16 g/mol. Its IUPAC name is (2S,9S)-2,9,13-triamino-N-[2-[4,5-bis(sulfanylmethyl)-2-[2-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]ethoxy]phenoxy]ethyl]-8-oxotridecanamide.
| Compound Name | (2S,9S)-2,9,13-triamino-N-[2-[4,5-bis(sulfanylmethyl)-2-[2-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]ethoxy]phenoxy]ethyl]-8-oxotridecanamide |
|---|---|
| PubChem CID | 158439544 |
| Molecular Formula | C38H70N8O6S2 |
| Molecular Weight | 799.16 g/mol |
| Exact Mass | 798.49 |
| IUPAC Name | (2S,9S)-2,9,13-triamino-N-[2-[4,5-bis(sulfanylmethyl)-2-[2-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]ethoxy]phenoxy]ethyl]-8-oxotridecanamide |
| SMILES | NCCCC[C@H](N)C(=O)CCCCC[C@H](N)C(=O)NCCOc1cc(CS)c(CS)cc1OCCNC(=O)[C@@H](N)CCCCCC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C38H70N8O6S2/c39-17-9-7-11-29(41)33(47)15-5-1-3-13-31(43)37(49)45-19-21-51-35-23-27(25-53)28(26-54)24-36(35)52-22-20-46-38(50)32(44)14-4-2-6-16-34(48)30(42)12-8-10-18-40/h23-24,29-32,53-54H,1-22,25-26,39-44H2,(H,45,49)(H,46,50)/t29-,30-,31-,32-/m0/s1 |
| InChIKey | RGHMTRAWZNNGPZ-YDPTYEFTSA-N |
| XLogP | 2.14 |
| TPSA | 266.92 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|