C28H51N9O4S — CID 159355415
(2S)-2,8-diamino-N-[2-[2-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-4-ethyl-5-(sulfanylmethyl)phenoxy]ethyl]-8-iminooctanamide (PubChem CID 159355415) has the molecular formula C28H51N9O4S and a molecular weight of 609.84 g/mol. Its IUPAC name is (2S)-2,8-diamino-N-[2-[2-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-4-ethyl-5-(sulfanylmethyl)phenoxy]ethyl]-8-iminooctanamide.
| Compound Name | (2S)-2,8-diamino-N-[2-[2-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-4-ethyl-5-(sulfanylmethyl)phenoxy]ethyl]-8-iminooctanamide |
|---|---|
| PubChem CID | 159355415 |
| Molecular Formula | C28H51N9O4S |
| Molecular Weight | 609.84 g/mol |
| Exact Mass | 609.38 |
| IUPAC Name | (2S)-2,8-diamino-N-[2-[2-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-4-ethyl-5-(sulfanylmethyl)phenoxy]ethyl]-8-iminooctanamide |
| SMILES | [H]/N=C(\N)CCCCC[C@H](N)C(=O)NCCOc1cc(CS)c(CC)cc1OCCNC(=O)[C@@H](N)CCCCN=C(N)N |
| InChI | InChI=1S/C28H51N9O4S/c1-2-19-16-23(40-14-12-36-27(39)22(30)9-6-7-11-37-28(33)34)24(17-20(19)18-42)41-15-13-35-26(38)21(29)8-4-3-5-10-25(31)32/h16-17,21-22,42H,2-15,18,29-30H2,1H3,(H3,31,32)(H,35,38)(H,36,39)(H4,33,34,37)/t21-,22-/m0/s1 |
| InChIKey | MWNWOXCNMQTWHC-VXKWHMMOSA-N |
| XLogP | 0.65 |
| TPSA | 242.97 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.84 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|