C19H33N7O2 — CID 166579721
4-amino-N-[(2R)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butan-2-yl]-2-ethylbenzamide (PubChem CID 166579721) has the molecular formula C19H33N7O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-amino-N-[(2R)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butan-2-yl]-2-ethylbenzamide.
| Compound Name | 4-amino-N-[(2R)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butan-2-yl]-2-ethylbenzamide |
|---|---|
| PubChem CID | 166579721 |
| Molecular Formula | C19H33N7O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 4-amino-N-[(2R)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butan-2-yl]-2-ethylbenzamide |
| SMILES | CCc1cc(N)ccc1C(=O)N[C@H](C)CCNC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C19H33N7O2/c1-3-13-11-14(20)6-7-15(13)17(27)26-12(2)8-10-24-18(28)16(21)5-4-9-25-19(22)23/h6-7,11-12,16H,3-5,8-10,20-21H2,1-2H3,(H,24,28)(H,26,27)(H4,22,23,25)/t12-,16+/m1/s1 |
| InChIKey | DBEXOSCRSJAGGZ-WBMJQRKESA-N |
| XLogP | -0.16 |
| TPSA | 174.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|