C26H46N10O4S2 — CID 121460200
(2S)-2-amino-N-[2-[[6-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-1,4-dihydro-2,3-benzodithiin-7-yl]oxy]ethyl]-6-(diaminomethylideneamino)hexanamide (PubChem CID 121460200) has the molecular formula C26H46N10O4S2 and a molecular weight of 626.85 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[[6-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-1,4-dihydro-2,3-benzodithiin-7-yl]oxy]ethyl]-6-(diaminomethylideneamino)hexanamide.
| Compound Name | (2S)-2-amino-N-[2-[[6-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-1,4-dihydro-2,3-benzodithiin-7-yl]oxy]ethyl]-6-(diaminomethylideneamino)hexanamide |
|---|---|
| PubChem CID | 121460200 |
| Molecular Formula | C26H46N10O4S2 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | (2S)-2-amino-N-[2-[[6-[2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]ethoxy]-1,4-dihydro-2,3-benzodithiin-7-yl]oxy]ethyl]-6-(diaminomethylideneamino)hexanamide |
| SMILES | NC(N)=NCCCC[C@H](N)C(=O)NCCOc1cc2c(cc1OCCNC(=O)[C@@H](N)CCCCN=C(N)N)CSSC2 |
| InChI | InChI=1S/C26H46N10O4S2/c27-19(5-1-3-7-35-25(29)30)23(37)33-9-11-39-21-13-17-15-41-42-16-18(17)14-22(21)40-12-10-34-24(38)20(28)6-2-4-8-36-26(31)32/h13-14,19-20H,1-12,15-16,27-28H2,(H,33,37)(H,34,38)(H4,29,30,35)(H4,31,32,36)/t19-,20-/m0/s1 |
| InChIKey | JDQBRJNSIQWIIG-PMACEKPBSA-N |
| XLogP | -0.39 |
| TPSA | 257.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|