C16H26BrN3O3 — CID 168944871
(2S)-2,6-diamino-N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]hexanamide (PubChem CID 168944871) has the molecular formula C16H26BrN3O3 and a molecular weight of 388.31 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]hexanamide |
|---|---|
| PubChem CID | 168944871 |
| Molecular Formula | C16H26BrN3O3 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]hexanamide |
| SMILES | COc1cc(CCNC(=O)[C@@H](N)CCCCN)c(OC)cc1Br |
| InChI | InChI=1S/C16H26BrN3O3/c1-22-14-10-12(17)15(23-2)9-11(14)6-8-20-16(21)13(19)5-3-4-7-18/h9-10,13H,3-8,18-19H2,1-2H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | SEUMVZSRVLTWFZ-ZDUSSCGKSA-N |
| XLogP | 1.58 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|