C15H21BrN2O6 — CID 168944840
ethylcarbamoyloxymethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate (PubChem CID 168944840) has the molecular formula C15H21BrN2O6 and a molecular weight of 405.25 g/mol. Its IUPAC name is ethylcarbamoyloxymethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate.
| Compound Name | ethylcarbamoyloxymethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 168944840 |
| Molecular Formula | C15H21BrN2O6 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | ethylcarbamoyloxymethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate |
| SMILES | CCNC(=O)OCOC(=O)NCCc1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C15H21BrN2O6/c1-4-17-14(19)23-9-24-15(20)18-6-5-10-7-13(22-3)11(16)8-12(10)21-2/h7-8H,4-6,9H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | KSERGEBETVCNMA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|