C14H21BrN2O3 — CID 168945007
N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]acetamide (PubChem CID 168945007) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]acetamide.
| Compound Name | N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 168945007 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]acetamide |
| SMILES | COc1cc(CCNC(C)NC(C)=O)c(OC)cc1Br |
| InChI | InChI=1S/C14H21BrN2O3/c1-9(17-10(2)18)16-6-5-11-7-14(20-4)12(15)8-13(11)19-3/h7-9,16H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | CMUWOTFUYZWJML-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|