C17H27BrN2O3 — CID 168944959
N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]-2,2-dimethylpropanamide (PubChem CID 168944959) has the molecular formula C17H27BrN2O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 168944959 |
| Molecular Formula | C17H27BrN2O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[1-[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]ethyl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(CCNC(C)NC(=O)C(C)(C)C)c(OC)cc1Br |
| InChI | InChI=1S/C17H27BrN2O3/c1-11(20-16(21)17(2,3)4)19-8-7-12-9-15(23-6)13(18)10-14(12)22-5/h9-11,19H,7-8H2,1-6H3,(H,20,21) |
| InChIKey | BOAXMGNXSAWPEZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|