C22H26BrNO5 — CID 168944888
tert-butyl 2-[2-(4-bromo-2,5-dimethoxyphenyl)ethylcarbamoyl]benzoate (PubChem CID 168944888) has the molecular formula C22H26BrNO5 and a molecular weight of 464.36 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-bromo-2,5-dimethoxyphenyl)ethylcarbamoyl]benzoate.
| Compound Name | tert-butyl 2-[2-(4-bromo-2,5-dimethoxyphenyl)ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 168944888 |
| Molecular Formula | C22H26BrNO5 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | tert-butyl 2-[2-(4-bromo-2,5-dimethoxyphenyl)ethylcarbamoyl]benzoate |
| SMILES | COc1cc(CCNC(=O)c2ccccc2C(=O)OC(C)(C)C)c(OC)cc1Br |
| InChI | InChI=1S/C22H26BrNO5/c1-22(2,3)29-21(26)16-9-7-6-8-15(16)20(25)24-11-10-14-12-19(28-5)17(23)13-18(14)27-4/h6-9,12-13H,10-11H2,1-5H3,(H,24,25) |
| InChIKey | PHNFYPRHHIRHCD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |