C13H19BrO3S — CID 103706018
3-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]butan-2-ol (PubChem CID 103706018) has the molecular formula C13H19BrO3S and a molecular weight of 335.26 g/mol. Its IUPAC name is 3-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]butan-2-ol.
| Compound Name | 3-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 103706018 |
| Molecular Formula | C13H19BrO3S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]butan-2-ol |
| SMILES | COc1cc(CSC(C)C(C)O)c(OC)cc1Br |
| InChI | InChI=1S/C13H19BrO3S/c1-8(15)9(2)18-7-10-5-13(17-4)11(14)6-12(10)16-3/h5-6,8-9,15H,7H2,1-4H3 |
| InChIKey | NQKBOIUFMSVCLO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |