C11H17Br2NO2 — CID 102602641
(2S)-1-(4-bromo-2,5-dimethoxyphenyl)propan-2-amine;hydrobromide (PubChem CID 102602641) has the molecular formula C11H17Br2NO2 and a molecular weight of 355.07 g/mol. Its IUPAC name is (2S)-1-(4-bromo-2,5-dimethoxyphenyl)propan-2-amine;hydrobromide.
| Compound Name | (2S)-1-(4-bromo-2,5-dimethoxyphenyl)propan-2-amine;hydrobromide |
|---|---|
| PubChem CID | 102602641 |
| Molecular Formula | C11H17Br2NO2 |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | (2S)-1-(4-bromo-2,5-dimethoxyphenyl)propan-2-amine;hydrobromide |
| SMILES | Br.COc1cc(C[C@H](C)N)c(OC)cc1Br |
| InChI | InChI=1S/C11H16BrNO2.BrH/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2;/h5-7H,4,13H2,1-3H3;1H/t7-;/m0./s1 |
| InChIKey | KOUBEZAODVTFTG-FJXQXJEOSA-N |
| XLogP | 2.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |