C16H27NO2S — CID 11461761
1-(2,5-dimethoxy-4-pentylsulfanylphenyl)propan-2-amine (PubChem CID 11461761) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-4-pentylsulfanylphenyl)propan-2-amine.
| Compound Name | 1-(2,5-dimethoxy-4-pentylsulfanylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 11461761 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(2,5-dimethoxy-4-pentylsulfanylphenyl)propan-2-amine |
| SMILES | CCCCCSc1cc(OC)c(CC(C)N)cc1OC |
| InChI | InChI=1S/C16H27NO2S/c1-5-6-7-8-20-16-11-14(18-3)13(9-12(2)17)10-15(16)19-4/h10-12H,5-9,17H2,1-4H3 |
| InChIKey | QJIMRIAYMMVZRY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|