C16H24F3NO2 — CID 165123589
1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]propan-2-amine (PubChem CID 165123589) has the molecular formula C16H24F3NO2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]propan-2-amine.
| Compound Name | 1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 165123589 |
| Molecular Formula | C16H24F3NO2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]propan-2-amine |
| SMILES | COc1cc(CC(C)N)c(OC)cc1CCCCC(F)(F)F |
| InChI | InChI=1S/C16H24F3NO2/c1-11(20)8-13-10-14(21-2)12(9-15(13)22-3)6-4-5-7-16(17,18)19/h9-11H,4-8,20H2,1-3H3 |
| InChIKey | ZQIHXFUWUJORSO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|