C16H25F2NO2 — CID 176553694
1-[4-(3,3-difluorobutyl)-2,5-dimethoxyphenyl]butan-2-amine (PubChem CID 176553694) has the molecular formula C16H25F2NO2 and a molecular weight of 301.38 g/mol. Its IUPAC name is 1-[4-(3,3-difluorobutyl)-2,5-dimethoxyphenyl]butan-2-amine.
| Compound Name | 1-[4-(3,3-difluorobutyl)-2,5-dimethoxyphenyl]butan-2-amine |
|---|---|
| PubChem CID | 176553694 |
| Molecular Formula | C16H25F2NO2 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[4-(3,3-difluorobutyl)-2,5-dimethoxyphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(OC)c(CCC(C)(F)F)cc1OC |
| InChI | InChI=1S/C16H25F2NO2/c1-5-13(19)8-12-10-14(20-3)11(9-15(12)21-4)6-7-16(2,17)18/h9-10,13H,5-8,19H2,1-4H3 |
| InChIKey | LOLZPHDLUZBTAW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |