C12H17ClF3NO2 — CID 170889486
1-[2-methoxy-4-(trifluoromethoxy)phenyl]butan-2-amine;hydrochloride (PubChem CID 170889486) has the molecular formula C12H17ClF3NO2 and a molecular weight of 299.72 g/mol. Its IUPAC name is 1-[2-methoxy-4-(trifluoromethoxy)phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[2-methoxy-4-(trifluoromethoxy)phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889486 |
| Molecular Formula | C12H17ClF3NO2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[2-methoxy-4-(trifluoromethoxy)phenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccc(OC(F)(F)F)cc1OC.Cl |
| InChI | InChI=1S/C12H16F3NO2.ClH/c1-3-9(16)6-8-4-5-10(7-11(8)17-2)18-12(13,14)15;/h4-5,7,9H,3,6,16H2,1-2H3;1H |
| InChIKey | BBQYFFAVHUEEKX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |