C11H15ClF3NO3 — CID 170893691
2-amino-3-[4-methoxy-2-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride (PubChem CID 170893691) has the molecular formula C11H15ClF3NO3 and a molecular weight of 301.69 g/mol. Its IUPAC name is 2-amino-3-[4-methoxy-2-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-[4-methoxy-2-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170893691 |
| Molecular Formula | C11H15ClF3NO3 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-amino-3-[4-methoxy-2-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride |
| SMILES | COc1ccc(CC(N)CO)c(OC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H14F3NO3.ClH/c1-17-9-3-2-7(4-8(15)6-16)10(5-9)18-11(12,13)14;/h2-3,5,8,16H,4,6,15H2,1H3;1H |
| InChIKey | STZGLMRDAXERIT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |