C14H22ClNO5 — CID 170892521
4-[4-(2-amino-3-hydroxypropyl)-3-methoxyphenoxy]butanoic acid;hydrochloride (PubChem CID 170892521) has the molecular formula C14H22ClNO5 and a molecular weight of 319.79 g/mol. Its IUPAC name is 4-[4-(2-amino-3-hydroxypropyl)-3-methoxyphenoxy]butanoic acid;hydrochloride.
| Compound Name | 4-[4-(2-amino-3-hydroxypropyl)-3-methoxyphenoxy]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 170892521 |
| Molecular Formula | C14H22ClNO5 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-[4-(2-amino-3-hydroxypropyl)-3-methoxyphenoxy]butanoic acid;hydrochloride |
| SMILES | COc1cc(OCCCC(=O)O)ccc1CC(N)CO.Cl |
| InChI | InChI=1S/C14H21NO5.ClH/c1-19-13-8-12(20-6-2-3-14(17)18)5-4-10(13)7-11(15)9-16;/h4-5,8,11,16H,2-3,6-7,9,15H2,1H3,(H,17,18);1H |
| InChIKey | BDSCALFMHAHKEZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|