C13H19NO5 — CID 68627883
4-[4-(aminomethyl)-3,5-dimethoxyphenoxy]butanoic acid (PubChem CID 68627883) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-3,5-dimethoxyphenoxy]butanoic acid.
| Compound Name | 4-[4-(aminomethyl)-3,5-dimethoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 68627883 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[4-(aminomethyl)-3,5-dimethoxyphenoxy]butanoic acid |
| SMILES | COc1cc(OCCCC(=O)O)cc(OC)c1CN |
| InChI | InChI=1S/C13H19NO5/c1-17-11-6-9(19-5-3-4-13(15)16)7-12(18-2)10(11)8-14/h6-7H,3-5,8,14H2,1-2H3,(H,15,16) |
| InChIKey | PFWBNFTYPLYWPX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|